About (3-ethylpiperidin-1-yl) acetate
(3-ethylpiperidin-1-yl) acetate (PubChem CID 174686534) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (3-ethylpiperidin-1-yl) acetate.
Molecular Properties
| Compound Name | (3-ethylpiperidin-1-yl) acetate |
| PubChem CID | 174686534 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (3-ethylpiperidin-1-yl) acetate |
| SMILES | CCC1CCCN(OC(C)=O)C1 |
| InChI | InChI=1S/C9H17NO2/c1-3-9-5-4-6-10(7-9)12-8(2)11/h9H,3-7H2,1-2H3 |
| InChIKey | YNPZYIMRGQDTEW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-ethylpiperidin-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylpiperidin-1-yl) acetate?
The IUPAC name of (3-ethylpiperidin-1-yl) acetate (CID 174686534) is (3-ethylpiperidin-1-yl) acetate.
What is the SMILES notation for (3-ethylpiperidin-1-yl) acetate?
The canonical SMILES for (3-ethylpiperidin-1-yl) acetate is CCC1CCCN(OC(C)=O)C1.
What is the InChIKey of (3-ethylpiperidin-1-yl) acetate?
The InChIKey is YNPZYIMRGQDTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-3-9-5-4-6-10(7-9)12-8(2)11/h9H,3-7H2,1-2H3.
What are the key properties of (3-ethylpiperidin-1-yl) acetate?
(3-ethylpiperidin-1-yl) acetate has a molecular weight of 171.24 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylpiperidin-1-yl) acetate is sourced from PubChem (CID 174686534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).