About [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate
[4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate (PubChem CID 174686655) has the molecular formula C8H8F3N3O4
and a molecular weight of 267.16 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate.
Molecular Properties
| Compound Name | [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate |
| PubChem CID | 174686655 |
| Molecular Formula | C8H8F3N3O4 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate |
| SMILES | O=COC(Cc1[nH]ncc1[N+](=O)[O-])CC(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O4/c9-8(10,11)2-5(18-4-15)1-6-7(14(16)17)3-12-13-6/h3-5H,1-2H2,(H,12,13) |
| InChIKey | CEDXLAQWKPPSGZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate?
The IUPAC name of [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate (CID 174686655) is [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate.
What is the SMILES notation for [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate?
The canonical SMILES for [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate is O=COC(Cc1[nH]ncc1[N+](=O)[O-])CC(F)(F)F.
What is the InChIKey of [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate?
The InChIKey is CEDXLAQWKPPSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3O4/c9-8(10,11)2-5(18-4-15)1-6-7(14(16)17)3-12-13-6/h3-5H,1-2H2,(H,12,13).
What are the key properties of [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate?
[4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate has a molecular weight of 267.16 g/mol, XLogP of 1.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4,4-trifluoro-1-(4-nitro-1H-pyrazol-5-yl)butan-2-yl] formate is sourced from PubChem (CID 174686655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).