C6H12O9 — CID 174687358
trans-(4R,6R)-cyclohexane-1,1,2,2,3,3,4,5,6-nonol (PubChem CID 174687358) has the molecular formula C6H12O9 and a molecular weight of 228.15 g/mol. Its IUPAC name is trans-(4R,6R)-cyclohexane-1,1,2,2,3,3,4,5,6-nonol.
| Compound Name | trans-(4R,6R)-cyclohexane-1,1,2,2,3,3,4,5,6-nonol |
|---|---|
| PubChem CID | 174687358 |
| Molecular Formula | C6H12O9 |
| Molecular Weight | 228.15 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | trans-(4R,6R)-cyclohexane-1,1,2,2,3,3,4,5,6-nonol |
| SMILES | OC1[C@@H](O)C(O)(O)C(O)(O)C(O)(O)[C@@H]1O |
| InChI | InChI=1S/C6H12O9/c7-1-2(8)4(10,11)6(14,15)5(12,13)3(1)9/h1-3,7-15H/t2-,3-/m1/s1 |
| InChIKey | OEQWFXUOBTUTIE-PWNYCUMCSA-N |
| XLogP | -5.87 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.15 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|