About 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene
1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene (PubChem CID 174687991) has the molecular formula C12H6F4OS2
and a molecular weight of 306.31 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene |
| PubChem CID | 174687991 |
| Molecular Formula | C12H6F4OS2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(SOSc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C12H6F4OS2/c13-7-1-8(14)4-11(3-7)18-17-19-12-5-9(15)2-10(16)6-12/h1-6H |
| InChIKey | XVKLNBYLCIPUME-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene?
The IUPAC name of 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene (CID 174687991) is 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene.
What is the SMILES notation for 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene?
The canonical SMILES for 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene is Fc1cc(F)cc(SOSc2cc(F)cc(F)c2)c1.
What is the InChIKey of 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene?
The InChIKey is XVKLNBYLCIPUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F4OS2/c13-7-1-8(14)4-11(3-7)18-17-19-12-5-9(15)2-10(16)6-12/h1-6H.
What are the key properties of 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene?
1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene has a molecular weight of 306.31 g/mol, XLogP of 4.97, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-difluorophenyl)sulfanyloxysulfanyl-3,5-difluorobenzene is sourced from PubChem (CID 174687991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).