C11H12ClNO4 — CID 174688321
4-(2-chlorophenyl)-N,4-dihydroxy-N-methyl-2-oxobutanamide (PubChem CID 174688321) has the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N,4-dihydroxy-N-methyl-2-oxobutanamide.
| Compound Name | 4-(2-chlorophenyl)-N,4-dihydroxy-N-methyl-2-oxobutanamide |
|---|---|
| PubChem CID | 174688321 |
| Molecular Formula | C11H12ClNO4 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(2-chlorophenyl)-N,4-dihydroxy-N-methyl-2-oxobutanamide |
| SMILES | CN(O)C(=O)C(=O)CC(O)c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClNO4/c1-13(17)11(16)10(15)6-9(14)7-4-2-3-5-8(7)12/h2-5,9,14,17H,6H2,1H3 |
| InChIKey | TZGMVDYGLKCBQT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|