C11H19N3 — CID 174688700
1,1,2,3-tetramethyl-3-(2-methylcyclopenta-1,3-dien-1-yl)guanidine (PubChem CID 174688700) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1,1,2,3-tetramethyl-3-(2-methylcyclopenta-1,3-dien-1-yl)guanidine.
| Compound Name | 1,1,2,3-tetramethyl-3-(2-methylcyclopenta-1,3-dien-1-yl)guanidine |
|---|---|
| PubChem CID | 174688700 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1,1,2,3-tetramethyl-3-(2-methylcyclopenta-1,3-dien-1-yl)guanidine |
| SMILES | C/N=C(\N(C)C)N(C)C1=C(C)C=CC1 |
| InChI | InChI=1S/C11H19N3/c1-9-7-6-8-10(9)14(5)11(12-2)13(3)4/h6-7H,8H2,1-5H3/b12-11+ |
| InChIKey | HQASXZILCQYBPI-VAWYXSNFSA-N |
| XLogP | 1.70 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|