C11H13Cl3N2 — CID 174688841
1,2-dichloro-1-(3-chlorophenyl)ethanamine;propanenitrile (PubChem CID 174688841) has the molecular formula C11H13Cl3N2 and a molecular weight of 279.60 g/mol. Its IUPAC name is 1,2-dichloro-1-(3-chlorophenyl)ethanamine;propanenitrile.
| Compound Name | 1,2-dichloro-1-(3-chlorophenyl)ethanamine;propanenitrile |
|---|---|
| PubChem CID | 174688841 |
| Molecular Formula | C11H13Cl3N2 |
| Molecular Weight | 279.60 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 1,2-dichloro-1-(3-chlorophenyl)ethanamine;propanenitrile |
| SMILES | CCC#N.NC(Cl)(CCl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H8Cl3N.C3H5N/c9-5-8(11,12)6-2-1-3-7(10)4-6;1-2-3-4/h1-4H,5,12H2;2H2,1H3 |
| InChIKey | IBTDAVLXBCIXPL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|