About 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole
5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole (PubChem CID 174688845) has the molecular formula C6H8FN5
and a molecular weight of 169.16 g/mol. Its IUPAC name is 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole.
Molecular Properties
| Compound Name | 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole |
| PubChem CID | 174688845 |
| Molecular Formula | C6H8FN5 |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole |
| SMILES | Cn1nnc([C@H]2C=C(F)CN2)n1 |
| InChI | InChI=1S/C6H8FN5/c1-12-10-6(9-11-12)5-2-4(7)3-8-5/h2,5,8H,3H2,1H3/t5-/m1/s1 |
| InChIKey | NNLCXQUCEZDSQE-RXMQYKEDSA-N |
| XLogP | -0.29 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole?
The IUPAC name of 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole (CID 174688845) is 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole.
What is the SMILES notation for 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole?
The canonical SMILES for 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole is Cn1nnc([C@H]2C=C(F)CN2)n1.
What is the InChIKey of 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole?
The InChIKey is NNLCXQUCEZDSQE-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H8FN5/c1-12-10-6(9-11-12)5-2-4(7)3-8-5/h2,5,8H,3H2,1H3/t5-/m1/s1.
What are the key properties of 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole?
5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole has a molecular weight of 169.16 g/mol, XLogP of -0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2R)-4-fluoro-2,5-dihydro-1H-pyrrol-2-yl]-2-methyltetrazole is sourced from PubChem (CID 174688845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).