C12H16O6 — CID 174688891
6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid;propan-1-ol (PubChem CID 174688891) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is 6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid;propan-1-ol.
| Compound Name | 6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid;propan-1-ol |
|---|---|
| PubChem CID | 174688891 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 6-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid;propan-1-ol |
| SMILES | CC12OC1(C(=O)O)C=CC=C2C(=O)O.CCCO |
| InChI | InChI=1S/C9H8O5.C3H8O/c1-8-5(6(10)11)3-2-4-9(8,14-8)7(12)13;1-2-3-4/h2-4H,1H3,(H,10,11)(H,12,13);4H,2-3H2,1H3 |
| InChIKey | WPBCVPJSAUULOY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|