About N,N-dimethylmethanamine;oxalonitrile;silane
N,N-dimethylmethanamine;oxalonitrile;silane (PubChem CID 174689189) has the molecular formula C5H13N3Si
and a molecular weight of 143.27 g/mol. Its IUPAC name is N,N-dimethylmethanamine;oxalonitrile;silane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;oxalonitrile;silane |
| PubChem CID | 174689189 |
| Molecular Formula | C5H13N3Si |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N,N-dimethylmethanamine;oxalonitrile;silane |
| SMILES | CN(C)C.N#CC#N.[SiH4] |
| InChI | InChI=1S/C3H9N.C2N2.H4Si/c1-4(2)3;3-1-2-4;/h1-3H3;;1H4 |
| InChIKey | JSEXWFXMPNFHEN-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;oxalonitrile;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;oxalonitrile;silane?
The IUPAC name of N,N-dimethylmethanamine;oxalonitrile;silane (CID 174689189) is N,N-dimethylmethanamine;oxalonitrile;silane.
What is the SMILES notation for N,N-dimethylmethanamine;oxalonitrile;silane?
The canonical SMILES for N,N-dimethylmethanamine;oxalonitrile;silane is CN(C)C.N#CC#N.[SiH4].
What is the InChIKey of N,N-dimethylmethanamine;oxalonitrile;silane?
The InChIKey is JSEXWFXMPNFHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2N2.H4Si/c1-4(2)3;3-1-2-4;/h1-3H3;;1H4.
What are the key properties of N,N-dimethylmethanamine;oxalonitrile;silane?
N,N-dimethylmethanamine;oxalonitrile;silane has a molecular weight of 143.27 g/mol, XLogP of -1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;oxalonitrile;silane is sourced from PubChem (CID 174689189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).