About [2-(chloromethyl)-1,3-thiazol-4-yl] acetate
[2-(chloromethyl)-1,3-thiazol-4-yl] acetate (PubChem CID 174689931) has the molecular formula C6H6ClNO2S
and a molecular weight of 191.64 g/mol. Its IUPAC name is [2-(chloromethyl)-1,3-thiazol-4-yl] acetate.
Molecular Properties
| Compound Name | [2-(chloromethyl)-1,3-thiazol-4-yl] acetate |
| PubChem CID | 174689931 |
| Molecular Formula | C6H6ClNO2S |
| Molecular Weight | 191.64 g/mol |
| Exact Mass | 190.98 |
| IUPAC Name | [2-(chloromethyl)-1,3-thiazol-4-yl] acetate |
| SMILES | CC(=O)Oc1csc(CCl)n1 |
| InChI | InChI=1S/C6H6ClNO2S/c1-4(9)10-5-3-11-6(2-7)8-5/h3H,2H2,1H3 |
| InChIKey | NLZPGKMGWJXEQX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.64 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [2-(chloromethyl)-1,3-thiazol-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(chloromethyl)-1,3-thiazol-4-yl] acetate?
The IUPAC name of [2-(chloromethyl)-1,3-thiazol-4-yl] acetate (CID 174689931) is [2-(chloromethyl)-1,3-thiazol-4-yl] acetate.
What is the SMILES notation for [2-(chloromethyl)-1,3-thiazol-4-yl] acetate?
The canonical SMILES for [2-(chloromethyl)-1,3-thiazol-4-yl] acetate is CC(=O)Oc1csc(CCl)n1.
What is the InChIKey of [2-(chloromethyl)-1,3-thiazol-4-yl] acetate?
The InChIKey is NLZPGKMGWJXEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO2S/c1-4(9)10-5-3-11-6(2-7)8-5/h3H,2H2,1H3.
What are the key properties of [2-(chloromethyl)-1,3-thiazol-4-yl] acetate?
[2-(chloromethyl)-1,3-thiazol-4-yl] acetate has a molecular weight of 191.64 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(chloromethyl)-1,3-thiazol-4-yl] acetate is sourced from PubChem (CID 174689931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).