About N,N-dimethylmethanamine;(Z)-octadec-9-enal
N,N-dimethylmethanamine;(Z)-octadec-9-enal (PubChem CID 174690016) has the molecular formula C21H43NO
and a molecular weight of 325.58 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(Z)-octadec-9-enal.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;(Z)-octadec-9-enal |
| PubChem CID | 174690016 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | N,N-dimethylmethanamine;(Z)-octadec-9-enal |
| SMILES | CCCCCCCC/C=C\CCCCCCCC=O.CN(C)C |
| InChI | InChI=1S/C18H34O.C3H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(2)3/h9-10,18H,2-8,11-17H2,1H3;1-3H3/b10-9-; |
| InChIKey | RLGQTQFQPZUGGH-KVVVOXFISA-N |
| XLogP | 6.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;(Z)-octadec-9-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;(Z)-octadec-9-enal?
The IUPAC name of N,N-dimethylmethanamine;(Z)-octadec-9-enal (CID 174690016) is N,N-dimethylmethanamine;(Z)-octadec-9-enal.
What is the SMILES notation for N,N-dimethylmethanamine;(Z)-octadec-9-enal?
The canonical SMILES for N,N-dimethylmethanamine;(Z)-octadec-9-enal is CCCCCCCC/C=C\CCCCCCCC=O.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;(Z)-octadec-9-enal?
The InChIKey is RLGQTQFQPZUGGH-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O.C3H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(2)3/h9-10,18H,2-8,11-17H2,1H3;1-3H3/b10-9-;.
What are the key properties of N,N-dimethylmethanamine;(Z)-octadec-9-enal?
N,N-dimethylmethanamine;(Z)-octadec-9-enal has a molecular weight of 325.58 g/mol, XLogP of 6.40, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;(Z)-octadec-9-enal is sourced from PubChem (CID 174690016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).