About [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate
[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate (PubChem CID 174690631) has the molecular formula C20H15F2N7O2
and a molecular weight of 423.38 g/mol. Its IUPAC name is [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate.
Molecular Properties
| Compound Name | [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate |
| PubChem CID | 174690631 |
| Molecular Formula | C20H15F2N7O2 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate |
| SMILES | CN(C(=O)Oc1cnc(N)c(-c2nnnn2-c2cccc(F)c2F)c1)c1ccccc1 |
| InChI | InChI=1S/C20H15F2N7O2/c1-28(12-6-3-2-4-7-12)20(30)31-13-10-14(18(23)24-11-13)19-25-26-27-29(19)16-9-5-8-15(21)17(16)22/h2-11H,1H3,(H2,23,24) |
| InChIKey | XFTCMKWQPCSTQM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate?
The IUPAC name of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate (CID 174690631) is [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate.
What is the SMILES notation for [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate?
The canonical SMILES for [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate is CN(C(=O)Oc1cnc(N)c(-c2nnnn2-c2cccc(F)c2F)c1)c1ccccc1.
What is the InChIKey of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate?
The InChIKey is XFTCMKWQPCSTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N7O2/c1-28(12-6-3-2-4-7-12)20(30)31-13-10-14(18(23)24-11-13)19-25-26-27-29(19)16-9-5-8-15(21)17(16)22/h2-11H,1H3,(H2,23,24).
What are the key properties of [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate?
[6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate has a molecular weight of 423.38 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-amino-5-[1-(2,3-difluorophenyl)tetrazol-5-yl]-3-pyridinyl] N-methyl-N-phenylcarbamate is sourced from PubChem (CID 174690631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).