About N-dodecylmethanimine oxide
N-dodecylmethanimine oxide (PubChem CID 174690762) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is N-dodecylmethanimine oxide.
Molecular Properties
| Compound Name | N-dodecylmethanimine oxide |
| PubChem CID | 174690762 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | N-dodecylmethanimine oxide |
| SMILES | C=[N+]([O-])CCCCCCCCCCCC |
| InChI | InChI=1S/C13H27NO/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h2-13H2,1H3 |
| InChIKey | DEVLUMAVMJDOMO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-dodecylmethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-dodecylmethanimine oxide?
The IUPAC name of N-dodecylmethanimine oxide (CID 174690762) is N-dodecylmethanimine oxide.
What is the SMILES notation for N-dodecylmethanimine oxide?
The canonical SMILES for N-dodecylmethanimine oxide is C=[N+]([O-])CCCCCCCCCCCC.
What is the InChIKey of N-dodecylmethanimine oxide?
The InChIKey is DEVLUMAVMJDOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h2-13H2,1H3.
What are the key properties of N-dodecylmethanimine oxide?
N-dodecylmethanimine oxide has a molecular weight of 213.36 g/mol, XLogP of 4.12, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-dodecylmethanimine oxide is sourced from PubChem (CID 174690762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).