C24H25N3O6 — CID 174691339
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;2-(4-phenyldiazenylphenyl)ethyl carbamate (PubChem CID 174691339) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;2-(4-phenyldiazenylphenyl)ethyl carbamate.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;2-(4-phenyldiazenylphenyl)ethyl carbamate |
|---|---|
| PubChem CID | 174691339 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;2-(4-phenyldiazenylphenyl)ethyl carbamate |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.NC(=O)OCCc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C15H15N3O2.C9H10O4/c16-15(19)20-11-10-12-6-8-14(9-7-12)18-17-13-4-2-1-3-5-13;1-9(8(12)13)4-2-3-6(5-9)7(10)11/h1-9H,10-11H2,(H2,16,19);2-4H,5H2,1H3,(H,10,11)(H,12,13)/b18-17+; |
| InChIKey | OSGSNNQZJVNMMD-ZAGWXBKKSA-N |
| XLogP | 4.79 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|