About [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene
[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene (PubChem CID 174692686) has the molecular formula C25H35NO3
and a molecular weight of 397.56 g/mol. Its IUPAC name is [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene.
Molecular Properties
| Compound Name | [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene |
| PubChem CID | 174692686 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene |
| SMILES | CCC(C)C(=O)ON1CCC(C)(c2cccc(O)c2)C(C)C1.Cc1ccccc1 |
| InChI | InChI=1S/C18H27NO3.C7H8/c1-5-13(2)17(21)22-19-10-9-18(4,14(3)12-19)15-7-6-8-16(20)11-15;1-7-5-3-2-4-6-7/h6-8,11,13-14,20H,5,9-10,12H2,1-4H3;2-6H,1H3 |
| InChIKey | MEXMLGVBNYZGRX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene?
The IUPAC name of [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene (CID 174692686) is [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene.
What is the SMILES notation for [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene?
The canonical SMILES for [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene is CCC(C)C(=O)ON1CCC(C)(c2cccc(O)c2)C(C)C1.Cc1ccccc1.
What is the InChIKey of [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene?
The InChIKey is MEXMLGVBNYZGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO3.C7H8/c1-5-13(2)17(21)22-19-10-9-18(4,14(3)12-19)15-7-6-8-16(20)11-15;1-7-5-3-2-4-6-7/h6-8,11,13-14,20H,5,9-10,12H2,1-4H3;2-6H,1H3.
What are the key properties of [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene?
[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene has a molecular weight of 397.56 g/mol, XLogP of 5.49, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl] 2-methylbutanoate;toluene is sourced from PubChem (CID 174692686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).