About N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane
N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane (PubChem CID 174693112) has the molecular formula C24H51NO
and a molecular weight of 369.68 g/mol. Its IUPAC name is N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane |
| PubChem CID | 174693112 |
| Molecular Formula | C24H51NO |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 369.40 |
| IUPAC Name | N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane |
| SMILES | CCC.CCCCCCCC/C=C\CCCCCCCC=O.CN(C)C |
| InChI | InChI=1S/C18H34O.C3H9N.C3H8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(2)3;1-3-2/h9-10,18H,2-8,11-17H2,1H3;1-3H3;3H2,1-2H3/b10-9-;; |
| InChIKey | WMOIHYLHQDRNJW-XXAVUKJNSA-N |
| XLogP | 7.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane?
The IUPAC name of N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane (CID 174693112) is N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane.
What is the SMILES notation for N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane?
The canonical SMILES for N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane is CCC.CCCCCCCC/C=C\CCCCCCCC=O.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane?
The InChIKey is WMOIHYLHQDRNJW-XXAVUKJNSA-N. The full InChI is InChI=1S/C18H34O.C3H9N.C3H8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-4(2)3;1-3-2/h9-10,18H,2-8,11-17H2,1H3;1-3H3;3H2,1-2H3/b10-9-;;.
What are the key properties of N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane?
N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane has a molecular weight of 369.68 g/mol, XLogP of 7.82, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;(Z)-octadec-9-enal;propane is sourced from PubChem (CID 174693112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).