About azane;1-methyl-5-phenyl-4-propyltriazole
azane;1-methyl-5-phenyl-4-propyltriazole (PubChem CID 174693231) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is azane;1-methyl-5-phenyl-4-propyltriazole.
Molecular Properties
| Compound Name | azane;1-methyl-5-phenyl-4-propyltriazole |
| PubChem CID | 174693231 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | azane;1-methyl-5-phenyl-4-propyltriazole |
| SMILES | CCCc1nnn(C)c1-c1ccccc1.N |
| InChI | InChI=1S/C12H15N3.H3N/c1-3-7-11-12(15(2)14-13-11)10-8-5-4-6-9-10;/h4-6,8-9H,3,7H2,1-2H3;1H3 |
| InChIKey | ZXNLOVRVGIABQD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;1-methyl-5-phenyl-4-propyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-methyl-5-phenyl-4-propyltriazole?
The IUPAC name of azane;1-methyl-5-phenyl-4-propyltriazole (CID 174693231) is azane;1-methyl-5-phenyl-4-propyltriazole.
What is the SMILES notation for azane;1-methyl-5-phenyl-4-propyltriazole?
The canonical SMILES for azane;1-methyl-5-phenyl-4-propyltriazole is CCCc1nnn(C)c1-c1ccccc1.N.
What is the InChIKey of azane;1-methyl-5-phenyl-4-propyltriazole?
The InChIKey is ZXNLOVRVGIABQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3.H3N/c1-3-7-11-12(15(2)14-13-11)10-8-5-4-6-9-10;/h4-6,8-9H,3,7H2,1-2H3;1H3.
What are the key properties of azane;1-methyl-5-phenyl-4-propyltriazole?
azane;1-methyl-5-phenyl-4-propyltriazole has a molecular weight of 218.30 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-methyl-5-phenyl-4-propyltriazole is sourced from PubChem (CID 174693231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).