C16H14N2O2 — CID 174693498
1-(4,4-diisocyanatocyclohexa-1,5-dien-1-yl)-2,3-dimethylbenzene (PubChem CID 174693498) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-(4,4-diisocyanatocyclohexa-1,5-dien-1-yl)-2,3-dimethylbenzene.
| Compound Name | 1-(4,4-diisocyanatocyclohexa-1,5-dien-1-yl)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 174693498 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(4,4-diisocyanatocyclohexa-1,5-dien-1-yl)-2,3-dimethylbenzene |
| SMILES | Cc1cccc(C2=CCC(N=C=O)(N=C=O)C=C2)c1C |
| InChI | InChI=1S/C16H14N2O2/c1-12-4-3-5-15(13(12)2)14-6-8-16(9-7-14,17-10-19)18-11-20/h3-8H,9H2,1-2H3 |
| InChIKey | JVPANGWXUFDGHZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|