About methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane
methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane (PubChem CID 174694018) has the molecular formula C11H19F3OSi
and a molecular weight of 252.35 g/mol. Its IUPAC name is methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane.
Molecular Properties
| Compound Name | methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane |
| PubChem CID | 174694018 |
| Molecular Formula | C11H19F3OSi |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane |
| SMILES | C[SiH2]C1(C=CCCC(F)(F)F)CCCCO1 |
| InChI | InChI=1S/C11H19F3OSi/c1-16-10(7-4-5-9-15-10)6-2-3-8-11(12,13)14/h2,6H,3-5,7-9,16H2,1H3 |
| InChIKey | FGUFWOJEGWLLHO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane?
The IUPAC name of methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane (CID 174694018) is methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane.
What is the SMILES notation for methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane?
The canonical SMILES for methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane is C[SiH2]C1(C=CCCC(F)(F)F)CCCCO1.
What is the InChIKey of methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane?
The InChIKey is FGUFWOJEGWLLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3OSi/c1-16-10(7-4-5-9-15-10)6-2-3-8-11(12,13)14/h2,6H,3-5,7-9,16H2,1H3.
What are the key properties of methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane?
methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane has a molecular weight of 252.35 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[2-(5,5,5-trifluoropent-1-enyl)oxan-2-yl]silane is sourced from PubChem (CID 174694018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).