About 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole
1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole (PubChem CID 174694141) has the molecular formula C11H12F2N2S
and a molecular weight of 242.29 g/mol. Its IUPAC name is 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole.
Molecular Properties
| Compound Name | 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole |
| PubChem CID | 174694141 |
| Molecular Formula | C11H12F2N2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole |
| SMILES | CCCCn1nccc1-c1sc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2S/c1-2-3-6-15-9(4-5-14-15)11-8(12)7-10(13)16-11/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | TZFLMXZOJQLTHY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole?
The IUPAC name of 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole (CID 174694141) is 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole.
What is the SMILES notation for 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole?
The canonical SMILES for 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole is CCCCn1nccc1-c1sc(F)cc1F.
What is the InChIKey of 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole?
The InChIKey is TZFLMXZOJQLTHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2S/c1-2-3-6-15-9(4-5-14-15)11-8(12)7-10(13)16-11/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole?
1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole has a molecular weight of 242.29 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-(3,5-difluorothiophen-2-yl)pyrazole is sourced from PubChem (CID 174694141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).