About 2H-benzotriazole;1-pentylpiperazine
2H-benzotriazole;1-pentylpiperazine (PubChem CID 174694727) has the molecular formula C15H25N5
and a molecular weight of 275.40 g/mol. Its IUPAC name is 2H-benzotriazole;1-pentylpiperazine.
Molecular Properties
| Compound Name | 2H-benzotriazole;1-pentylpiperazine |
| PubChem CID | 174694727 |
| Molecular Formula | C15H25N5 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2H-benzotriazole;1-pentylpiperazine |
| SMILES | CCCCCN1CCNCC1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C9H20N2.C6H5N3/c1-2-3-4-7-11-8-5-10-6-9-11;1-2-4-6-5(3-1)7-9-8-6/h10H,2-9H2,1H3;1-4H,(H,7,8,9) |
| InChIKey | INXBWPJHJGLLHM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazole;1-pentylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;1-pentylpiperazine?
The IUPAC name of 2H-benzotriazole;1-pentylpiperazine (CID 174694727) is 2H-benzotriazole;1-pentylpiperazine.
What is the SMILES notation for 2H-benzotriazole;1-pentylpiperazine?
The canonical SMILES for 2H-benzotriazole;1-pentylpiperazine is CCCCCN1CCNCC1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;1-pentylpiperazine?
The InChIKey is INXBWPJHJGLLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.C6H5N3/c1-2-3-4-7-11-8-5-10-6-9-11;1-2-4-6-5(3-1)7-9-8-6/h10H,2-9H2,1H3;1-4H,(H,7,8,9).
What are the key properties of 2H-benzotriazole;1-pentylpiperazine?
2H-benzotriazole;1-pentylpiperazine has a molecular weight of 275.40 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;1-pentylpiperazine is sourced from PubChem (CID 174694727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).