About 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde
3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde (PubChem CID 174694960) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde |
| PubChem CID | 174694960 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde |
| SMILES | O=Cc1cccc(C2=N[C@H](Cc3ccccc3)CO2)c1 |
| InChI | InChI=1S/C17H15NO2/c19-11-14-7-4-8-15(9-14)17-18-16(12-20-17)10-13-5-2-1-3-6-13/h1-9,11,16H,10,12H2/t16-/m1/s1 |
| InChIKey | LXGBQYWFLIOQSV-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde?
The IUPAC name of 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde (CID 174694960) is 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde.
What is the SMILES notation for 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde?
The canonical SMILES for 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde is O=Cc1cccc(C2=N[C@H](Cc3ccccc3)CO2)c1.
What is the InChIKey of 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde?
The InChIKey is LXGBQYWFLIOQSV-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H15NO2/c19-11-14-7-4-8-15(9-14)17-18-16(12-20-17)10-13-5-2-1-3-6-13/h1-9,11,16H,10,12H2/t16-/m1/s1.
What are the key properties of 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde?
3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde has a molecular weight of 265.31 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]benzaldehyde is sourced from PubChem (CID 174694960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).