About methyl(trioctyl)phosphanium;phosphane;hydrobromide
methyl(trioctyl)phosphanium;phosphane;hydrobromide (PubChem CID 174695100) has the molecular formula C25H58BrP2+
and a molecular weight of 500.59 g/mol. Its IUPAC name is methyl(trioctyl)phosphanium;phosphane;hydrobromide.
Molecular Properties
| Compound Name | methyl(trioctyl)phosphanium;phosphane;hydrobromide |
| PubChem CID | 174695100 |
| Molecular Formula | C25H58BrP2+ |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | methyl(trioctyl)phosphanium;phosphane;hydrobromide |
| SMILES | Br.CCCCCCCC[P+](C)(CCCCCCCC)CCCCCCCC.P |
| InChI | InChI=1S/C25H54P.BrH.H3P/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;;/h5-25H2,1-4H3;1H;1H3/q+1;; |
| InChIKey | MVUDQGAUNADFJQ-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl(trioctyl)phosphanium;phosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl(trioctyl)phosphanium;phosphane;hydrobromide?
The IUPAC name of methyl(trioctyl)phosphanium;phosphane;hydrobromide (CID 174695100) is methyl(trioctyl)phosphanium;phosphane;hydrobromide.
What is the SMILES notation for methyl(trioctyl)phosphanium;phosphane;hydrobromide?
The canonical SMILES for methyl(trioctyl)phosphanium;phosphane;hydrobromide is Br.CCCCCCCC[P+](C)(CCCCCCCC)CCCCCCCC.P.
What is the InChIKey of methyl(trioctyl)phosphanium;phosphane;hydrobromide?
The InChIKey is MVUDQGAUNADFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H54P.BrH.H3P/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;;/h5-25H2,1-4H3;1H;1H3/q+1;;.
What are the key properties of methyl(trioctyl)phosphanium;phosphane;hydrobromide?
methyl(trioctyl)phosphanium;phosphane;hydrobromide has a molecular weight of 500.59 g/mol, XLogP of 10.35, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl(trioctyl)phosphanium;phosphane;hydrobromide is sourced from PubChem (CID 174695100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).