About 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole
1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole (PubChem CID 174695166) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole.
Molecular Properties
| Compound Name | 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole |
| PubChem CID | 174695166 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole |
| SMILES | COc1ccccc1.Cc1ccc2c(c1)c1cc(C)ccc1n2CC(O)CN |
| InChI | InChI=1S/C17H20N2O.C7H8O/c1-11-3-5-16-14(7-11)15-8-12(2)4-6-17(15)19(16)10-13(20)9-18;1-8-7-5-3-2-4-6-7/h3-8,13,20H,9-10,18H2,1-2H3;2-6H,1H3 |
| InChIKey | AXMGFMNSZOMCDE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole?
The IUPAC name of 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole (CID 174695166) is 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole.
What is the SMILES notation for 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole?
The canonical SMILES for 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole is COc1ccccc1.Cc1ccc2c(c1)c1cc(C)ccc1n2CC(O)CN.
What is the InChIKey of 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole?
The InChIKey is AXMGFMNSZOMCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O.C7H8O/c1-11-3-5-16-14(7-11)15-8-12(2)4-6-17(15)19(16)10-13(20)9-18;1-8-7-5-3-2-4-6-7/h3-8,13,20H,9-10,18H2,1-2H3;2-6H,1H3.
What are the key properties of 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole?
1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole has a molecular weight of 376.50 g/mol, XLogP of 4.43, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(3,6-dimethylcarbazol-9-yl)propan-2-ol;anisole is sourced from PubChem (CID 174695166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).