About (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate
(5-amino-1,2,4-thiadiazol-3-yl)methyl acetate (PubChem CID 174695288) has the molecular formula C5H7N3O2S
and a molecular weight of 173.20 g/mol. Its IUPAC name is (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate |
| PubChem CID | 174695288 |
| Molecular Formula | C5H7N3O2S |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate |
| SMILES | CC(=O)OCc1nsc(N)n1 |
| InChI | InChI=1S/C5H7N3O2S/c1-3(9)10-2-4-7-5(6)11-8-4/h2H2,1H3,(H2,6,7,8) |
| InChIKey | MXFHGGWHTCLOCI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate?
The IUPAC name of (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate (CID 174695288) is (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate.
What is the SMILES notation for (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate?
The canonical SMILES for (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate is CC(=O)OCc1nsc(N)n1.
What is the InChIKey of (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate?
The InChIKey is MXFHGGWHTCLOCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c1-3(9)10-2-4-7-5(6)11-8-4/h2H2,1H3,(H2,6,7,8).
What are the key properties of (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate?
(5-amino-1,2,4-thiadiazol-3-yl)methyl acetate has a molecular weight of 173.20 g/mol, XLogP of 0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,2,4-thiadiazol-3-yl)methyl acetate is sourced from PubChem (CID 174695288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).