C21H33N3O4 — CID 174695760
1-O-amino 3-O-tert-butyl 2-[(6-piperidin-1-yl-3-pyridinyl)methyl]-2-propan-2-ylpropanedioate (PubChem CID 174695760) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-O-amino 3-O-tert-butyl 2-[(6-piperidin-1-yl-3-pyridinyl)methyl]-2-propan-2-ylpropanedioate.
| Compound Name | 1-O-amino 3-O-tert-butyl 2-[(6-piperidin-1-yl-3-pyridinyl)methyl]-2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 174695760 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-O-amino 3-O-tert-butyl 2-[(6-piperidin-1-yl-3-pyridinyl)methyl]-2-propan-2-ylpropanedioate |
| SMILES | CC(C)C(Cc1ccc(N2CCCCC2)nc1)(C(=O)ON)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33N3O4/c1-15(2)21(19(26)28-22,18(25)27-20(3,4)5)13-16-9-10-17(23-14-16)24-11-7-6-8-12-24/h9-10,14-15H,6-8,11-13,22H2,1-5H3 |
| InChIKey | QTMPDVCTLXJGOF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|