C9H18O4Si4 — CID 174697109
2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;styrene (PubChem CID 174697109) has the molecular formula C9H18O4Si4 and a molecular weight of 302.58 g/mol. Its IUPAC name is 2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;styrene.
| Compound Name | 2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;styrene |
|---|---|
| PubChem CID | 174697109 |
| Molecular Formula | C9H18O4Si4 |
| Molecular Weight | 302.58 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-methyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;styrene |
| SMILES | C=Cc1ccccc1.C[SiH]1O[SiH2]O[SiH2]O[SiH2]O1 |
| InChI | InChI=1S/C8H8.CH10O4Si4/c1-2-8-6-4-3-5-7-8;1-9-4-7-2-6-3-8-5-9/h2-7H,1H2;9H,6-8H2,1H3 |
| InChIKey | WPMDMXAAQHMXER-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.58 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|