About ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate
ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate (PubChem CID 174697880) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate |
| PubChem CID | 174697880 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate |
| SMILES | CCOC(=O)NNC1Cc2ccc(O)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-24-19(23)21-20-18-11-14-8-9-15(22)12-16(14)17(18)10-13-6-4-3-5-7-13/h3-9,12,17-18,20,22H,2,10-11H2,1H3,(H,21,23) |
| InChIKey | HEEMBPWDWCBCBI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate?
The IUPAC name of ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate (CID 174697880) is ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate.
What is the SMILES notation for ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate?
The canonical SMILES for ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate is CCOC(=O)NNC1Cc2ccc(O)cc2C1Cc1ccccc1.
What is the InChIKey of ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate?
The InChIKey is HEEMBPWDWCBCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-2-24-19(23)21-20-18-11-14-8-9-15(22)12-16(14)17(18)10-13-6-4-3-5-7-13/h3-9,12,17-18,20,22H,2,10-11H2,1H3,(H,21,23).
What are the key properties of ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate?
ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate has a molecular weight of 326.40 g/mol, XLogP of 2.89, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(1-benzyl-6-hydroxy-2,3-dihydro-1H-inden-2-yl)amino]carbamate is sourced from PubChem (CID 174697880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).