C10H9F2N3O4S — CID 174698629
1-[2-cyano-3-(difluoromethoxy)phenyl]sulfonyl-1-methylurea (PubChem CID 174698629) has the molecular formula C10H9F2N3O4S and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-[2-cyano-3-(difluoromethoxy)phenyl]sulfonyl-1-methylurea.
| Compound Name | 1-[2-cyano-3-(difluoromethoxy)phenyl]sulfonyl-1-methylurea |
|---|---|
| PubChem CID | 174698629 |
| Molecular Formula | C10H9F2N3O4S |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-[2-cyano-3-(difluoromethoxy)phenyl]sulfonyl-1-methylurea |
| SMILES | CN(C(N)=O)S(=O)(=O)c1cccc(OC(F)F)c1C#N |
| InChI | InChI=1S/C10H9F2N3O4S/c1-15(10(14)16)20(17,18)8-4-2-3-7(6(8)5-13)19-9(11)12/h2-4,9H,1H3,(H2,14,16) |
| InChIKey | AWTZALZEQQQTNP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |