About 2-iminocyclohex-3-en-1-one;nickel
2-iminocyclohex-3-en-1-one;nickel (PubChem CID 174698832) has the molecular formula C6H7NNiO
and a molecular weight of 167.82 g/mol. Its IUPAC name is 2-iminocyclohex-3-en-1-one;nickel.
Molecular Properties
| Compound Name | 2-iminocyclohex-3-en-1-one;nickel |
| PubChem CID | 174698832 |
| Molecular Formula | C6H7NNiO |
| Molecular Weight | 167.82 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | 2-iminocyclohex-3-en-1-one;nickel |
| SMILES | [H]/N=C1\C=CCCC1=O.[Ni] |
| InChI | InChI=1S/C6H7NO.Ni/c7-5-3-1-2-4-6(5)8;/h1,3,7H,2,4H2;/b7-5+; |
| InChIKey | XTGBNFAMLSEUQL-GZOLSCHFSA-N |
| XLogP | 0.92 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.82 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminocyclohex-3-en-1-one;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminocyclohex-3-en-1-one;nickel?
The IUPAC name of 2-iminocyclohex-3-en-1-one;nickel (CID 174698832) is 2-iminocyclohex-3-en-1-one;nickel.
What is the SMILES notation for 2-iminocyclohex-3-en-1-one;nickel?
The canonical SMILES for 2-iminocyclohex-3-en-1-one;nickel is [H]/N=C1\C=CCCC1=O.[Ni].
What is the InChIKey of 2-iminocyclohex-3-en-1-one;nickel?
The InChIKey is XTGBNFAMLSEUQL-GZOLSCHFSA-N. The full InChI is InChI=1S/C6H7NO.Ni/c7-5-3-1-2-4-6(5)8;/h1,3,7H,2,4H2;/b7-5+;.
What are the key properties of 2-iminocyclohex-3-en-1-one;nickel?
2-iminocyclohex-3-en-1-one;nickel has a molecular weight of 167.82 g/mol, XLogP of 0.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminocyclohex-3-en-1-one;nickel is sourced from PubChem (CID 174698832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).