About cyclopenta-1,3-diene;iron(2+);2-methylphenolate
cyclopenta-1,3-diene;iron(2+);2-methylphenolate (PubChem CID 174698889) has the molecular formula C12H12FeO
and a molecular weight of 228.07 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);2-methylphenolate.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;iron(2+);2-methylphenolate |
| PubChem CID | 174698889 |
| Molecular Formula | C12H12FeO |
| Molecular Weight | 228.07 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);2-methylphenolate |
| SMILES | Cc1ccccc1[O-].[C-]1=CC=CC1.[Fe+2] |
| InChI | InChI=1S/C7H8O.C5H5.Fe/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1;/h2-5,8H,1H3;1-3H,4H2;/q;-1;+2/p-1 |
| InChIKey | YPAHHFSPUPOXNJ-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.07 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;iron(2+);2-methylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;iron(2+);2-methylphenolate?
The IUPAC name of cyclopenta-1,3-diene;iron(2+);2-methylphenolate (CID 174698889) is cyclopenta-1,3-diene;iron(2+);2-methylphenolate.
What is the SMILES notation for cyclopenta-1,3-diene;iron(2+);2-methylphenolate?
The canonical SMILES for cyclopenta-1,3-diene;iron(2+);2-methylphenolate is Cc1ccccc1[O-].[C-]1=CC=CC1.[Fe+2].
What is the InChIKey of cyclopenta-1,3-diene;iron(2+);2-methylphenolate?
The InChIKey is YPAHHFSPUPOXNJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O.C5H5.Fe/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1;/h2-5,8H,1H3;1-3H,4H2;/q;-1;+2/p-1.
What are the key properties of cyclopenta-1,3-diene;iron(2+);2-methylphenolate?
cyclopenta-1,3-diene;iron(2+);2-methylphenolate has a molecular weight of 228.07 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;iron(2+);2-methylphenolate is sourced from PubChem (CID 174698889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).