C11H10BrNO8S — CID 174699186
2-[2-bromo-5-(1,2-dicarboxyethyl)-1,3-thiazol-4-yl]butanedioic acid (PubChem CID 174699186) has the molecular formula C11H10BrNO8S and a molecular weight of 396.17 g/mol. Its IUPAC name is 2-[2-bromo-5-(1,2-dicarboxyethyl)-1,3-thiazol-4-yl]butanedioic acid.
| Compound Name | 2-[2-bromo-5-(1,2-dicarboxyethyl)-1,3-thiazol-4-yl]butanedioic acid |
|---|---|
| PubChem CID | 174699186 |
| Molecular Formula | C11H10BrNO8S |
| Molecular Weight | 396.17 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 2-[2-bromo-5-(1,2-dicarboxyethyl)-1,3-thiazol-4-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)c1nc(Br)sc1C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H10BrNO8S/c12-11-13-7(3(9(18)19)1-5(14)15)8(22-11)4(10(20)21)2-6(16)17/h3-4H,1-2H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | MPJAYKINUNFLFX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |