About 2-methylpropanenitrile;tetrachloromethane
2-methylpropanenitrile;tetrachloromethane (PubChem CID 174700163) has the molecular formula C5H7Cl4N
and a molecular weight of 222.93 g/mol. Its IUPAC name is 2-methylpropanenitrile;tetrachloromethane.
Molecular Properties
| Compound Name | 2-methylpropanenitrile;tetrachloromethane |
| PubChem CID | 174700163 |
| Molecular Formula | C5H7Cl4N |
| Molecular Weight | 222.93 g/mol |
| Exact Mass | 220.93 |
| IUPAC Name | 2-methylpropanenitrile;tetrachloromethane |
| SMILES | CC(C)C#N.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H7N.CCl4/c1-4(2)3-5;2-1(3,4)5/h4H,1-2H3; |
| InChIKey | YZWMOTAJRHYIRA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanenitrile;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanenitrile;tetrachloromethane?
The IUPAC name of 2-methylpropanenitrile;tetrachloromethane (CID 174700163) is 2-methylpropanenitrile;tetrachloromethane.
What is the SMILES notation for 2-methylpropanenitrile;tetrachloromethane?
The canonical SMILES for 2-methylpropanenitrile;tetrachloromethane is CC(C)C#N.ClC(Cl)(Cl)Cl.
What is the InChIKey of 2-methylpropanenitrile;tetrachloromethane?
The InChIKey is YZWMOTAJRHYIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N.CCl4/c1-4(2)3-5;2-1(3,4)5/h4H,1-2H3;.
What are the key properties of 2-methylpropanenitrile;tetrachloromethane?
2-methylpropanenitrile;tetrachloromethane has a molecular weight of 222.93 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanenitrile;tetrachloromethane is sourced from PubChem (CID 174700163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).