About cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide
cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide (PubChem CID 174700888) has the molecular formula C11H17HfI2-
and a molecular weight of 581.55 g/mol. Its IUPAC name is cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide.
Molecular Properties
| Compound Name | cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide |
| PubChem CID | 174700888 |
| Molecular Formula | C11H17HfI2- |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 582.89 |
| IUPAC Name | cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide |
| SMILES | I.I.[C-]1=C(C2CCCCC2)C=CC1.[Hf] |
| InChI | InChI=1S/C11H15.Hf.2HI/c1-2-6-10(7-3-1)11-8-4-5-9-11;;;/h4,8,10H,1-3,5-7H2;;2*1H/q-1;;; |
| InChIKey | RLQRJRWJEDIADA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide?
The IUPAC name of cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide (CID 174700888) is cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide.
What is the SMILES notation for cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide?
The canonical SMILES for cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide is I.I.[C-]1=C(C2CCCCC2)C=CC1.[Hf].
What is the InChIKey of cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide?
The InChIKey is RLQRJRWJEDIADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15.Hf.2HI/c1-2-6-10(7-3-1)11-8-4-5-9-11;;;/h4,8,10H,1-3,5-7H2;;2*1H/q-1;;;.
What are the key properties of cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide?
cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide has a molecular weight of 581.55 g/mol, XLogP of 4.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,4-dien-1-ylcyclohexane;hafnium;dihydroiodide is sourced from PubChem (CID 174700888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).