About 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole
4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole (PubChem CID 17470110) has the molecular formula C19H16N4
and a molecular weight of 300.37 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole.
Molecular Properties
| Compound Name | 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole |
| PubChem CID | 17470110 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole |
| SMILES | c1ccc(-c2nn(-c3ccccc3)cc2Cn2ccnc2)cc1 |
| InChI | InChI=1S/C19H16N4/c1-3-7-16(8-4-1)19-17(13-22-12-11-20-15-22)14-23(21-19)18-9-5-2-6-10-18/h1-12,14-15H,13H2 |
| InChIKey | NNUIEEDVJFTBCC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole?
The IUPAC name of 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole (CID 17470110) is 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole.
What is the SMILES notation for 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole?
The canonical SMILES for 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole is c1ccc(-c2nn(-c3ccccc3)cc2Cn2ccnc2)cc1.
What is the InChIKey of 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole?
The InChIKey is NNUIEEDVJFTBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4/c1-3-7-16(8-4-1)19-17(13-22-12-11-20-15-22)14-23(21-19)18-9-5-2-6-10-18/h1-12,14-15H,13H2.
What are the key properties of 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole?
4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole has a molecular weight of 300.37 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(imidazol-1-ylmethyl)-1,3-diphenylpyrazole is sourced from PubChem (CID 17470110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).