About (3-phosphonooxyphenyl) propanoate
(3-phosphonooxyphenyl) propanoate (PubChem CID 174701500) has the molecular formula C9H11O6P
and a molecular weight of 246.15 g/mol. Its IUPAC name is (3-phosphonooxyphenyl) propanoate.
Molecular Properties
| Compound Name | (3-phosphonooxyphenyl) propanoate |
| PubChem CID | 174701500 |
| Molecular Formula | C9H11O6P |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (3-phosphonooxyphenyl) propanoate |
| SMILES | CCC(=O)Oc1cccc(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C9H11O6P/c1-2-9(10)14-7-4-3-5-8(6-7)15-16(11,12)13/h3-6H,2H2,1H3,(H2,11,12,13) |
| InChIKey | XRSAPMSXRLPURB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-phosphonooxyphenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phosphonooxyphenyl) propanoate?
The IUPAC name of (3-phosphonooxyphenyl) propanoate (CID 174701500) is (3-phosphonooxyphenyl) propanoate.
What is the SMILES notation for (3-phosphonooxyphenyl) propanoate?
The canonical SMILES for (3-phosphonooxyphenyl) propanoate is CCC(=O)Oc1cccc(OP(=O)(O)O)c1.
What is the InChIKey of (3-phosphonooxyphenyl) propanoate?
The InChIKey is XRSAPMSXRLPURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O6P/c1-2-9(10)14-7-4-3-5-8(6-7)15-16(11,12)13/h3-6H,2H2,1H3,(H2,11,12,13).
What are the key properties of (3-phosphonooxyphenyl) propanoate?
(3-phosphonooxyphenyl) propanoate has a molecular weight of 246.15 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phosphonooxyphenyl) propanoate is sourced from PubChem (CID 174701500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).