About [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate
[4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate (PubChem CID 174702158) has the molecular formula C13H16F3NO2
and a molecular weight of 275.27 g/mol. Its IUPAC name is [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate |
| PubChem CID | 174702158 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate |
| SMILES | Cc1ccc(NOC(=O)C(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2/c1-8-5-6-9(7-10(8)13(14,15)16)17-19-11(18)12(2,3)4/h5-7,17H,1-4H3 |
| InChIKey | JYLBFGYWNQXNTK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate?
The IUPAC name of [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate (CID 174702158) is [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate.
What is the SMILES notation for [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate?
The canonical SMILES for [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate is Cc1ccc(NOC(=O)C(C)(C)C)cc1C(F)(F)F.
What is the InChIKey of [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate?
The InChIKey is JYLBFGYWNQXNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3NO2/c1-8-5-6-9(7-10(8)13(14,15)16)17-19-11(18)12(2,3)4/h5-7,17H,1-4H3.
What are the key properties of [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate?
[4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate has a molecular weight of 275.27 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-3-(trifluoromethyl)anilino] 2,2-dimethylpropanoate is sourced from PubChem (CID 174702158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).