About 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine
2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine (PubChem CID 174702175) has the molecular formula C17H12BrCl3F3N
and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine |
| PubChem CID | 174702175 |
| Molecular Formula | C17H12BrCl3F3N |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 470.92 |
| IUPAC Name | 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine |
| SMILES | FC(F)(F)C1(c2cc(Cl)c(Cl)c(Cl)c2)CNC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H12BrCl3F3N/c18-11-3-1-2-9(4-11)14-7-16(8-25-14,17(22,23)24)10-5-12(19)15(21)13(20)6-10/h1-6,14,25H,7-8H2 |
| InChIKey | YFHXNRQZTUFEET-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine?
The IUPAC name of 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine (CID 174702175) is 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine.
What is the SMILES notation for 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine?
The canonical SMILES for 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine is FC(F)(F)C1(c2cc(Cl)c(Cl)c(Cl)c2)CNC(c2cccc(Br)c2)C1.
What is the InChIKey of 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine?
The InChIKey is YFHXNRQZTUFEET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12BrCl3F3N/c18-11-3-1-2-9(4-11)14-7-16(8-25-14,17(22,23)24)10-5-12(19)15(21)13(20)6-10/h1-6,14,25H,7-8H2.
What are the key properties of 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine?
2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine has a molecular weight of 473.55 g/mol, XLogP of 6.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)-4-(3,4,5-trichlorophenyl)-4-(trifluoromethyl)pyrrolidine is sourced from PubChem (CID 174702175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).