About butan-1-amine;hydron;hexafluorophosphate
butan-1-amine;hydron;hexafluorophosphate (PubChem CID 174702640) has the molecular formula C4H12F6NP
and a molecular weight of 219.11 g/mol. Its IUPAC name is butan-1-amine;hydron;hexafluorophosphate.
Molecular Properties
| Compound Name | butan-1-amine;hydron;hexafluorophosphate |
| PubChem CID | 174702640 |
| Molecular Formula | C4H12F6NP |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | butan-1-amine;hydron;hexafluorophosphate |
| SMILES | CCCCN.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C4H11N.F6P/c1-2-3-4-5;1-7(2,3,4,5)6/h2-5H2,1H3;/q;-1/p+1 |
| InChIKey | HUBUHUYYVQTHGI-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;hydron;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;hydron;hexafluorophosphate?
The IUPAC name of butan-1-amine;hydron;hexafluorophosphate (CID 174702640) is butan-1-amine;hydron;hexafluorophosphate.
What is the SMILES notation for butan-1-amine;hydron;hexafluorophosphate?
The canonical SMILES for butan-1-amine;hydron;hexafluorophosphate is CCCCN.F[P-](F)(F)(F)(F)F.[H+].
What is the InChIKey of butan-1-amine;hydron;hexafluorophosphate?
The InChIKey is HUBUHUYYVQTHGI-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H11N.F6P/c1-2-3-4-5;1-7(2,3,4,5)6/h2-5H2,1H3;/q;-1/p+1.
What are the key properties of butan-1-amine;hydron;hexafluorophosphate?
butan-1-amine;hydron;hexafluorophosphate has a molecular weight of 219.11 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;hydron;hexafluorophosphate is sourced from PubChem (CID 174702640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).