About 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate
1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate (PubChem CID 174702666) has the molecular formula C12H10Cl2N2O2
and a molecular weight of 285.13 g/mol. Its IUPAC name is 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate.
Molecular Properties
| Compound Name | 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate |
| PubChem CID | 174702666 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate |
| SMILES | CC(OC(N)=O)c1cc2cccc(Cl)c2c(Cl)n1 |
| InChI | InChI=1S/C12H10Cl2N2O2/c1-6(18-12(15)17)9-5-7-3-2-4-8(13)10(7)11(14)16-9/h2-6H,1H3,(H2,15,17) |
| InChIKey | YPMBOXSHXGZCLW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate?
The IUPAC name of 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate (CID 174702666) is 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate.
What is the SMILES notation for 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate?
The canonical SMILES for 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate is CC(OC(N)=O)c1cc2cccc(Cl)c2c(Cl)n1.
What is the InChIKey of 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate?
The InChIKey is YPMBOXSHXGZCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2O2/c1-6(18-12(15)17)9-5-7-3-2-4-8(13)10(7)11(14)16-9/h2-6H,1H3,(H2,15,17).
What are the key properties of 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate?
1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate has a molecular weight of 285.13 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,8-dichloroisoquinolin-3-yl)ethyl carbamate is sourced from PubChem (CID 174702666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).