About 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene
5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene (PubChem CID 174703064) has the molecular formula C20H16BrFN4
and a molecular weight of 411.28 g/mol. Its IUPAC name is 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene.
Molecular Properties
| Compound Name | 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene |
| PubChem CID | 174703064 |
| Molecular Formula | C20H16BrFN4 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene |
| SMILES | Cn1nc(-c2ccccn2)cc1-c1ccc(Br)cn1.Fc1ccccc1 |
| InChI | InChI=1S/C14H11BrN4.C6H5F/c1-19-14(12-6-5-10(15)9-17-12)8-13(18-19)11-4-2-3-7-16-11;7-6-4-2-1-3-5-6/h2-9H,1H3;1-5H |
| InChIKey | KNUKDGFIMDBXOE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene?
The IUPAC name of 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene (CID 174703064) is 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene.
What is the SMILES notation for 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene?
The canonical SMILES for 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene is Cn1nc(-c2ccccn2)cc1-c1ccc(Br)cn1.Fc1ccccc1.
What is the InChIKey of 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene?
The InChIKey is KNUKDGFIMDBXOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN4.C6H5F/c1-19-14(12-6-5-10(15)9-17-12)8-13(18-19)11-4-2-3-7-16-11;7-6-4-2-1-3-5-6/h2-9H,1H3;1-5H.
What are the key properties of 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene?
5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene has a molecular weight of 411.28 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1-methyl-3-pyridin-2-ylpyrazol-5-yl)pyridine;fluorobenzene is sourced from PubChem (CID 174703064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).