C27H35F3N6O — CID 174703433
N-pyridin-4-yl-6-[4-[4-[2-(trifluoromethyl)butanimidoyl]cyclohexyl]-1,4-diazepan-1-yl]pyridine-2-carboxamide (PubChem CID 174703433) has the molecular formula C27H35F3N6O and a molecular weight of 516.61 g/mol. Its IUPAC name is N-pyridin-4-yl-6-[4-[4-[2-(trifluoromethyl)butanimidoyl]cyclohexyl]-1,4-diazepan-1-yl]pyridine-2-carboxamide.
| Compound Name | N-pyridin-4-yl-6-[4-[4-[2-(trifluoromethyl)butanimidoyl]cyclohexyl]-1,4-diazepan-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174703433 |
| Molecular Formula | C27H35F3N6O |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | N-pyridin-4-yl-6-[4-[4-[2-(trifluoromethyl)butanimidoyl]cyclohexyl]-1,4-diazepan-1-yl]pyridine-2-carboxamide |
| SMILES | [H]/N=C(/C1CCC(N2CCCN(c3cccc(C(=O)Nc4ccncc4)n3)CC2)CC1)C(CC)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N6O/c1-2-22(27(28,29)30)25(31)19-7-9-21(10-8-19)35-15-4-16-36(18-17-35)24-6-3-5-23(34-24)26(37)33-20-11-13-32-14-12-20/h3,5-6,11-14,19,21-22,31H,2,4,7-10,15-18H2,1H3,(H,32,33,37)/b31-25- |
| InChIKey | MRUWEZXNFOEBIJ-GDWJVWIDSA-N |
| XLogP | 5.41 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|