About 3-prop-2-enylpyrrole-2,5-dione;hydrobromide
3-prop-2-enylpyrrole-2,5-dione;hydrobromide (PubChem CID 174703436) has the molecular formula C7H8BrNO2
and a molecular weight of 218.05 g/mol. Its IUPAC name is 3-prop-2-enylpyrrole-2,5-dione;hydrobromide.
Molecular Properties
| Compound Name | 3-prop-2-enylpyrrole-2,5-dione;hydrobromide |
| PubChem CID | 174703436 |
| Molecular Formula | C7H8BrNO2 |
| Molecular Weight | 218.05 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 3-prop-2-enylpyrrole-2,5-dione;hydrobromide |
| SMILES | Br.C=CCC1=CC(=O)NC1=O |
| InChI | InChI=1S/C7H7NO2.BrH/c1-2-3-5-4-6(9)8-7(5)10;/h2,4H,1,3H2,(H,8,9,10);1H |
| InChIKey | UAPLVXKBRNQNQD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.05 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enylpyrrole-2,5-dione;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enylpyrrole-2,5-dione;hydrobromide?
The IUPAC name of 3-prop-2-enylpyrrole-2,5-dione;hydrobromide (CID 174703436) is 3-prop-2-enylpyrrole-2,5-dione;hydrobromide.
What is the SMILES notation for 3-prop-2-enylpyrrole-2,5-dione;hydrobromide?
The canonical SMILES for 3-prop-2-enylpyrrole-2,5-dione;hydrobromide is Br.C=CCC1=CC(=O)NC1=O.
What is the InChIKey of 3-prop-2-enylpyrrole-2,5-dione;hydrobromide?
The InChIKey is UAPLVXKBRNQNQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.BrH/c1-2-3-5-4-6(9)8-7(5)10;/h2,4H,1,3H2,(H,8,9,10);1H.
What are the key properties of 3-prop-2-enylpyrrole-2,5-dione;hydrobromide?
3-prop-2-enylpyrrole-2,5-dione;hydrobromide has a molecular weight of 218.05 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enylpyrrole-2,5-dione;hydrobromide is sourced from PubChem (CID 174703436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).