About copper;nitroformaldehyde
copper;nitroformaldehyde (PubChem CID 174703670) has the molecular formula CHCuNO3
and a molecular weight of 138.57 g/mol. Its IUPAC name is copper;nitroformaldehyde.
Molecular Properties
| Compound Name | copper;nitroformaldehyde |
| PubChem CID | 174703670 |
| Molecular Formula | CHCuNO3 |
| Molecular Weight | 138.57 g/mol |
| Exact Mass | 137.93 |
| IUPAC Name | copper;nitroformaldehyde |
| SMILES | O=C[N+](=O)[O-].[Cu] |
| InChI | InChI=1S/CHNO3.Cu/c3-1-2(4)5;/h1H; |
| InChIKey | BUIVGBVHDUKINE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.57 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;nitroformaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;nitroformaldehyde?
The IUPAC name of copper;nitroformaldehyde (CID 174703670) is copper;nitroformaldehyde.
What is the SMILES notation for copper;nitroformaldehyde?
The canonical SMILES for copper;nitroformaldehyde is O=C[N+](=O)[O-].[Cu].
What is the InChIKey of copper;nitroformaldehyde?
The InChIKey is BUIVGBVHDUKINE-UHFFFAOYSA-N. The full InChI is InChI=1S/CHNO3.Cu/c3-1-2(4)5;/h1H;.
What are the key properties of copper;nitroformaldehyde?
copper;nitroformaldehyde has a molecular weight of 138.57 g/mol, XLogP of -0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;nitroformaldehyde is sourced from PubChem (CID 174703670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).