About 1-benzothiophene;2H-thiadiazine
1-benzothiophene;2H-thiadiazine (PubChem CID 174703745) has the molecular formula C11H10N2S2
and a molecular weight of 234.35 g/mol. Its IUPAC name is 1-benzothiophene;2H-thiadiazine.
Molecular Properties
| Compound Name | 1-benzothiophene;2H-thiadiazine |
| PubChem CID | 174703745 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1-benzothiophene;2H-thiadiazine |
| SMILES | C1=CSNN=C1.c1ccc2sccc2c1 |
| InChI | InChI=1S/C8H6S.C3H4N2S/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-6-3-1/h1-6H;1-3,5H |
| InChIKey | NVDMNUVXLIGFBK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzothiophene;2H-thiadiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophene;2H-thiadiazine?
The IUPAC name of 1-benzothiophene;2H-thiadiazine (CID 174703745) is 1-benzothiophene;2H-thiadiazine.
What is the SMILES notation for 1-benzothiophene;2H-thiadiazine?
The canonical SMILES for 1-benzothiophene;2H-thiadiazine is C1=CSNN=C1.c1ccc2sccc2c1.
What is the InChIKey of 1-benzothiophene;2H-thiadiazine?
The InChIKey is NVDMNUVXLIGFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S.C3H4N2S/c1-2-4-8-7(3-1)5-6-9-8;1-2-4-5-6-3-1/h1-6H;1-3,5H.
What are the key properties of 1-benzothiophene;2H-thiadiazine?
1-benzothiophene;2H-thiadiazine has a molecular weight of 234.35 g/mol, XLogP of 3.64, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophene;2H-thiadiazine is sourced from PubChem (CID 174703745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).