About N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide
N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide (PubChem CID 174704044) has the molecular formula C15H18N2OS
and a molecular weight of 274.39 g/mol. Its IUPAC name is N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide.
Molecular Properties
| Compound Name | N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide |
| PubChem CID | 174704044 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide |
| SMILES | CC(C)(C)c1nc(NC=O)sc1Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2OS/c1-15(2,3)13-12(19-14(17-13)16-10-18)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H,16,17,18) |
| InChIKey | QHGZRCRNQDLOIG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide?
The IUPAC name of N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide (CID 174704044) is N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide.
What is the SMILES notation for N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide?
The canonical SMILES for N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide is CC(C)(C)c1nc(NC=O)sc1Cc1ccccc1.
What is the InChIKey of N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide?
The InChIKey is QHGZRCRNQDLOIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2OS/c1-15(2,3)13-12(19-14(17-13)16-10-18)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H,16,17,18).
What are the key properties of N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide?
N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide has a molecular weight of 274.39 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-benzyl-4-tert-butyl-1,3-thiazol-2-yl)formamide is sourced from PubChem (CID 174704044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).