C20H30O10S — CID 174704327
(2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-octanoyloxy-2-phenoxyoxane-2-sulfonic acid (PubChem CID 174704327) has the molecular formula C20H30O10S and a molecular weight of 462.52 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-octanoyloxy-2-phenoxyoxane-2-sulfonic acid.
| Compound Name | (2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-octanoyloxy-2-phenoxyoxane-2-sulfonic acid |
|---|---|
| PubChem CID | 174704327 |
| Molecular Formula | C20H30O10S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-octanoyloxy-2-phenoxyoxane-2-sulfonic acid |
| SMILES | CCCCCCCC(=O)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]1(Oc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C20H30O10S/c1-2-3-4-5-9-12-16(22)28-19-18(24)17(23)15(13-21)30-20(19,31(25,26)27)29-14-10-7-6-8-11-14/h6-8,10-11,15,17-19,21,23-24H,2-5,9,12-13H2,1H3,(H,25,26,27)/t15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | UUUPHOFLUIWFQA-LFZDHENXSA-N |
| XLogP | 0.99 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|