C20H28N4O3 — CID 174704779
tert-butyl formate;3-(piperidin-4-ylmethyl)-5-[(E)-2-pyridin-3-ylethenyl]-1,2,4-oxadiazole (PubChem CID 174704779) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl formate;3-(piperidin-4-ylmethyl)-5-[(E)-2-pyridin-3-ylethenyl]-1,2,4-oxadiazole.
| Compound Name | tert-butyl formate;3-(piperidin-4-ylmethyl)-5-[(E)-2-pyridin-3-ylethenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 174704779 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | tert-butyl formate;3-(piperidin-4-ylmethyl)-5-[(E)-2-pyridin-3-ylethenyl]-1,2,4-oxadiazole |
| SMILES | C(=C/c1nc(CC2CCNCC2)no1)\c1cccnc1.CC(C)(C)OC=O |
| InChI | InChI=1S/C15H18N4O.C5H10O2/c1-2-13(11-17-7-1)3-4-15-18-14(19-20-15)10-12-5-8-16-9-6-12;1-5(2,3)7-4-6/h1-4,7,11-12,16H,5-6,8-10H2;4H,1-3H3/b4-3+; |
| InChIKey | NMCJEUKRYXEFLA-BJILWQEISA-N |
| XLogP | 3.13 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|