C23H35N5O4S — CID 174704950
tert-butyl formate;4-N-methyl-6-N-(4-methylsulfonylphenyl)-4-N-(piperidin-4-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 174704950) has the molecular formula C23H35N5O4S and a molecular weight of 477.63 g/mol. Its IUPAC name is tert-butyl formate;4-N-methyl-6-N-(4-methylsulfonylphenyl)-4-N-(piperidin-4-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | tert-butyl formate;4-N-methyl-6-N-(4-methylsulfonylphenyl)-4-N-(piperidin-4-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 174704950 |
| Molecular Formula | C23H35N5O4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | tert-butyl formate;4-N-methyl-6-N-(4-methylsulfonylphenyl)-4-N-(piperidin-4-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)(C)OC=O.CN(CC1CCNCC1)c1cc(Nc2ccc(S(C)(=O)=O)cc2)ncn1 |
| InChI | InChI=1S/C18H25N5O2S.C5H10O2/c1-23(12-14-7-9-19-10-8-14)18-11-17(20-13-21-18)22-15-3-5-16(6-4-15)26(2,24)25;1-5(2,3)7-4-6/h3-6,11,13-14,19H,7-10,12H2,1-2H3,(H,20,21,22);4H,1-3H3 |
| InChIKey | HMHIFTRTMAUJAZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|